C23H29BrFN3O — CID 155064079
N-(3-bromophenyl)-N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide (PubChem CID 155064079) has the molecular formula C23H29BrFN3O and a molecular weight of 462.41 g/mol. Its IUPAC name is N-(3-bromophenyl)-N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide.
| Compound Name | N-(3-bromophenyl)-N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide |
|---|---|
| PubChem CID | 155064079 |
| Molecular Formula | C23H29BrFN3O |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-(3-bromophenyl)-N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide |
| SMILES | C=C(CCF)C(=O)N(CCCCCc1cc(C2CC2)nn1C)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H29BrFN3O/c1-17(12-13-25)23(29)28(21-9-6-7-19(24)15-21)14-5-3-4-8-20-16-22(18-10-11-18)26-27(20)2/h6-7,9,15-16,18H,1,3-5,8,10-14H2,2H3 |
| InChIKey | RROPCIMTKXUCMK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|