C29H34F3N3O3 — CID 166977110
N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-[4-(difluoromethoxy)phenyl]phenyl]-4-fluoro-2-methylidenebutanamide (PubChem CID 166977110) has the molecular formula C29H34F3N3O3 and a molecular weight of 529.60 g/mol. Its IUPAC name is N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-[4-(difluoromethoxy)phenyl]phenyl]-4-fluoro-2-methylidenebutanamide.
| Compound Name | N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-[4-(difluoromethoxy)phenyl]phenyl]-4-fluoro-2-methylidenebutanamide |
|---|---|
| PubChem CID | 166977110 |
| Molecular Formula | C29H34F3N3O3 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-[4-(difluoromethoxy)phenyl]phenyl]-4-fluoro-2-methylidenebutanamide |
| SMILES | C=C(CCF)C(=O)N(CCCCCc1nc(C(C)(C)C)no1)c1cccc(-c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C29H34F3N3O3/c1-20(16-17-30)26(36)35(18-7-5-6-11-25-33-27(34-38-25)29(2,3)4)23-10-8-9-22(19-23)21-12-14-24(15-13-21)37-28(31)32/h8-10,12-15,19,28H,1,5-7,11,16-18H2,2-4H3 |
| InChIKey | WYZLBIDPNRFJBR-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|