C27H34FN5O3 — CID 166976975
N-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide (PubChem CID 166976975) has the molecular formula C27H34FN5O3 and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide.
| Compound Name | N-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide |
|---|---|
| PubChem CID | 166976975 |
| Molecular Formula | C27H34FN5O3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | N-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidenebutanamide |
| SMILES | C=C(CCF)C(=O)N(CCCCCc1nc(C2CC2)no1)c1cccc(-c2noc(C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C27H34FN5O3/c1-18(14-15-28)25(34)33(16-7-5-6-11-22-29-23(31-35-22)19-12-13-19)21-10-8-9-20(17-21)24-30-26(36-32-24)27(2,3)4/h8-10,17,19H,1,5-7,11-16H2,2-4H3 |
| InChIKey | SUXXODCCEJBKDC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|