C28H31F4N3O2 — CID 166976740
4-fluoro-2-methylidene-N-[3-(2-propyl-1,3-oxazol-5-yl)phenyl]-N-[5-[4-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide (PubChem CID 166976740) has the molecular formula C28H31F4N3O2 and a molecular weight of 517.57 g/mol. Its IUPAC name is 4-fluoro-2-methylidene-N-[3-(2-propyl-1,3-oxazol-5-yl)phenyl]-N-[5-[4-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide.
| Compound Name | 4-fluoro-2-methylidene-N-[3-(2-propyl-1,3-oxazol-5-yl)phenyl]-N-[5-[4-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide |
|---|---|
| PubChem CID | 166976740 |
| Molecular Formula | C28H31F4N3O2 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 4-fluoro-2-methylidene-N-[3-(2-propyl-1,3-oxazol-5-yl)phenyl]-N-[5-[4-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide |
| SMILES | C=C(CCF)C(=O)N(CCCCCc1cc(C(F)(F)F)ccn1)c1cccc(-c2cnc(CCC)o2)c1 |
| InChI | InChI=1S/C28H31F4N3O2/c1-3-8-26-34-19-25(37-26)21-9-7-11-24(17-21)35(27(36)20(2)12-14-29)16-6-4-5-10-23-18-22(13-15-33-23)28(30,31)32/h7,9,11,13,15,17-19H,2-6,8,10,12,14,16H2,1H3 |
| InChIKey | KYMIUGKXWVPPOP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|