C28H31F3N4O — CID 154683010
N-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide (PubChem CID 154683010) has the molecular formula C28H31F3N4O and a molecular weight of 496.58 g/mol. Its IUPAC name is N-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide.
| Compound Name | N-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide |
|---|---|
| PubChem CID | 154683010 |
| Molecular Formula | C28H31F3N4O |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]pentyl]butanamide |
| SMILES | CCCC(=O)N(CCCCCc1ccc(C(F)(F)F)cn1)c1cccc(-c2cnc(C3CC3)nc2)c1 |
| InChI | InChI=1S/C28H31F3N4O/c1-2-7-26(36)35(15-5-3-4-9-24-14-13-23(19-32-24)28(29,30)31)25-10-6-8-21(16-25)22-17-33-27(34-18-22)20-11-12-20/h6,8,10,13-14,16-20H,2-5,7,9,11-12,15H2,1H3 |
| InChIKey | VKKFIVGBSHTZBA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|