C30H32F3N5O3 — CID 166976783
N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[4-[5-(2,2-difluorocyclopropyl)-1,2,4-oxadiazol-3-yl]-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-2-methylidenebutanamide (PubChem CID 166976783) has the molecular formula C30H32F3N5O3 and a molecular weight of 567.61 g/mol. Its IUPAC name is N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[4-[5-(2,2-difluorocyclopropyl)-1,2,4-oxadiazol-3-yl]-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-2-methylidenebutanamide.
| Compound Name | N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[4-[5-(2,2-difluorocyclopropyl)-1,2,4-oxadiazol-3-yl]-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-2-methylidenebutanamide |
|---|---|
| PubChem CID | 166976783 |
| Molecular Formula | C30H32F3N5O3 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[4-[5-(2,2-difluorocyclopropyl)-1,2,4-oxadiazol-3-yl]-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-2-methylidenebutanamide |
| SMILES | C=C(CCF)C(=O)N(CC12CCC(c3noc(C4CC4(F)F)n3)(CC1)CC2)c1cccc(-c2nc(C3CC3)no2)c1 |
| InChI | InChI=1S/C30H32F3N5O3/c1-18(7-14-31)26(39)38(21-4-2-3-20(15-21)24-34-23(36-40-24)19-5-6-19)17-28-8-11-29(12-9-28,13-10-28)27-35-25(41-37-27)22-16-30(22,32)33/h2-4,15,19,22H,1,5-14,16-17H2 |
| InChIKey | WIZJXKMFEJOUBP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|