C26H31F2N5O4 — CID 166976767
N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-ethoxy-1,3,4-oxadiazol-2-yl)phenyl]-3,3-difluorocyclopentane-1-carboxamide (PubChem CID 166976767) has the molecular formula C26H31F2N5O4 and a molecular weight of 515.56 g/mol. Its IUPAC name is N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-ethoxy-1,3,4-oxadiazol-2-yl)phenyl]-3,3-difluorocyclopentane-1-carboxamide.
| Compound Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-ethoxy-1,3,4-oxadiazol-2-yl)phenyl]-3,3-difluorocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 166976767 |
| Molecular Formula | C26H31F2N5O4 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(5-ethoxy-1,3,4-oxadiazol-2-yl)phenyl]-3,3-difluorocyclopentane-1-carboxamide |
| SMILES | CCOc1nnc(-c2cccc(N(CCCCCc3nc(C4CC4)no3)C(=O)C3CCC(F)(F)C3)c2)o1 |
| InChI | InChI=1S/C26H31F2N5O4/c1-2-35-25-31-30-23(36-25)18-7-6-8-20(15-18)33(24(34)19-12-13-26(27,28)16-19)14-5-3-4-9-21-29-22(32-37-21)17-10-11-17/h6-8,15,17,19H,2-5,9-14,16H2,1H3 |
| InChIKey | JWXJEICLCMINBI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 107.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|