C21H25BrF3N3O2 — CID 154683455
N-(3-bromophenyl)-N-[5-[3-(difluoromethyl)-1,2,4-oxadiazol-5-yl]pentyl]-4-fluoropent-4-enamide;ethene (PubChem CID 154683455) has the molecular formula C21H25BrF3N3O2 and a molecular weight of 488.35 g/mol. Its IUPAC name is N-(3-bromophenyl)-N-[5-[3-(difluoromethyl)-1,2,4-oxadiazol-5-yl]pentyl]-4-fluoropent-4-enamide;ethene.
| Compound Name | N-(3-bromophenyl)-N-[5-[3-(difluoromethyl)-1,2,4-oxadiazol-5-yl]pentyl]-4-fluoropent-4-enamide;ethene |
|---|---|
| PubChem CID | 154683455 |
| Molecular Formula | C21H25BrF3N3O2 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-(3-bromophenyl)-N-[5-[3-(difluoromethyl)-1,2,4-oxadiazol-5-yl]pentyl]-4-fluoropent-4-enamide;ethene |
| SMILES | C=C.C=C(F)CCC(=O)N(CCCCCc1nc(C(F)F)no1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H21BrF3N3O2.C2H4/c1-13(21)9-10-17(27)26(15-7-5-6-14(20)12-15)11-4-2-3-8-16-24-19(18(22)23)25-28-16;1-2/h5-7,12,18H,1-4,8-11H2;1-2H2 |
| InChIKey | IUODZPJPPGSCDC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|