C20H27N5O2 — CID 154683572
ethene;3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-[5-(3-methyl-1,2,4-oxadiazol-5-yl)pentyl]aniline (PubChem CID 154683572) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is ethene;3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-[5-(3-methyl-1,2,4-oxadiazol-5-yl)pentyl]aniline.
| Compound Name | ethene;3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-[5-(3-methyl-1,2,4-oxadiazol-5-yl)pentyl]aniline |
|---|---|
| PubChem CID | 154683572 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | ethene;3-(3-ethyl-1,2,4-oxadiazol-5-yl)-N-[5-(3-methyl-1,2,4-oxadiazol-5-yl)pentyl]aniline |
| SMILES | C=C.CCc1noc(-c2cccc(NCCCCCc3nc(C)no3)c2)n1 |
| InChI | InChI=1S/C18H23N5O2.C2H4/c1-3-16-21-18(25-23-16)14-8-7-9-15(12-14)19-11-6-4-5-10-17-20-13(2)22-24-17;1-2/h7-9,12,19H,3-6,10-11H2,1-2H3;1-2H2 |
| InChIKey | XJSXMYIVLBZWSF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|