About 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile
2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile (PubChem CID 168542942) has the molecular formula C14H11N5O
and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile |
| PubChem CID | 168542942 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile |
| SMILES | CCc1noc(-c2cccc(NC=C(C#N)C#N)c2)n1 |
| InChI | InChI=1S/C14H11N5O/c1-2-13-18-14(20-19-13)11-4-3-5-12(6-11)17-9-10(7-15)8-16/h3-6,9,17H,2H2,1H3 |
| InChIKey | JSCCNXCEUODREQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile?
The IUPAC name of 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile (CID 168542942) is 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile.
What is the SMILES notation for 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile?
The canonical SMILES for 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile is CCc1noc(-c2cccc(NC=C(C#N)C#N)c2)n1.
What is the InChIKey of 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile?
The InChIKey is JSCCNXCEUODREQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O/c1-2-13-18-14(20-19-13)11-4-3-5-12(6-11)17-9-10(7-15)8-16/h3-6,9,17H,2H2,1H3.
What are the key properties of 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile?
2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile has a molecular weight of 265.28 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]methylidene]propanedinitrile is sourced from PubChem (CID 168542942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).