C22H29N5O2 — CID 155063225
N-[5-(5-tert-butyl-1,3,4-oxadiazol-2-yl)pentyl]-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 155063225) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[5-(5-tert-butyl-1,3,4-oxadiazol-2-yl)pentyl]-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | N-[5-(5-tert-butyl-1,3,4-oxadiazol-2-yl)pentyl]-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 155063225 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-[5-(5-tert-butyl-1,3,4-oxadiazol-2-yl)pentyl]-3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | CC(C)(C)c1nnc(CCCCCNc2cccc(-c3nc(C4CC4)no3)c2)o1 |
| InChI | InChI=1S/C22H29N5O2/c1-22(2,3)21-26-25-18(28-21)10-5-4-6-13-23-17-9-7-8-16(14-17)20-24-19(27-29-20)15-11-12-15/h7-9,14-15,23H,4-6,10-13H2,1-3H3 |
| InChIKey | HPYOVDMTIABRAE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|