C25H31N5O2 — CID 154682979
N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-3-(2-cyclopropyloxypyrimidin-4-yl)aniline;ethene (PubChem CID 154682979) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-3-(2-cyclopropyloxypyrimidin-4-yl)aniline;ethene.
| Compound Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-3-(2-cyclopropyloxypyrimidin-4-yl)aniline;ethene |
|---|---|
| PubChem CID | 154682979 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-3-(2-cyclopropyloxypyrimidin-4-yl)aniline;ethene |
| SMILES | C=C.c1cc(NCCCCCc2nc(C3CC3)no2)cc(-c2ccnc(OC3CC3)n2)c1 |
| InChI | InChI=1S/C23H27N5O2.C2H4/c1(2-7-21-27-22(28-30-21)16-8-9-16)3-13-24-18-6-4-5-17(15-18)20-12-14-25-23(26-20)29-19-10-11-19;1-2/h4-6,12,14-16,19,24H,1-3,7-11,13H2;1-2H2 |
| InChIKey | SVRDURKAJNJXGK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|