C23H28N4O2 — CID 166977002
N-[6-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)hexan-2-yl]-3-(2-cyclopropyl-1,3-oxazol-5-yl)aniline (PubChem CID 166977002) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[6-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)hexan-2-yl]-3-(2-cyclopropyl-1,3-oxazol-5-yl)aniline.
| Compound Name | N-[6-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)hexan-2-yl]-3-(2-cyclopropyl-1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 166977002 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[6-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)hexan-2-yl]-3-(2-cyclopropyl-1,3-oxazol-5-yl)aniline |
| SMILES | CC(CCCCc1nc(C2CC2)no1)Nc1cccc(-c2cnc(C3CC3)o2)c1 |
| InChI | InChI=1S/C23H28N4O2/c1-15(5-2-3-8-21-26-22(27-29-21)16-9-10-16)25-19-7-4-6-18(13-19)20-14-24-23(28-20)17-11-12-17/h4,6-7,13-17,25H,2-3,5,8-12H2,1H3 |
| InChIKey | JUUQAOVNJPIUMQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|