C12H12N2O2S — CID 146461396
(3R)-3-(4-cyanophenyl)sulfanylpyrrolidine-1-carboxylic acid (PubChem CID 146461396) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is (3R)-3-(4-cyanophenyl)sulfanylpyrrolidine-1-carboxylic acid.
| Compound Name | (3R)-3-(4-cyanophenyl)sulfanylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 146461396 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (3R)-3-(4-cyanophenyl)sulfanylpyrrolidine-1-carboxylic acid |
| SMILES | N#Cc1ccc(S[C@@H]2CCN(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C12H12N2O2S/c13-7-9-1-3-10(4-2-9)17-11-5-6-14(8-11)12(15)16/h1-4,11H,5-6,8H2,(H,15,16)/t11-/m1/s1 |
| InChIKey | UHXLSENWUHAJKE-LLVKDONJSA-N |
| XLogP | 2.40 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |