C27H28N4O6 — CID 146469741
4-[[3-(4-aminophenyl)-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoyl]amino]-N-hydroxybenzamide (PubChem CID 146469741) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is 4-[[3-(4-aminophenyl)-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoyl]amino]-N-hydroxybenzamide.
| Compound Name | 4-[[3-(4-aminophenyl)-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoyl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 146469741 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 4-[[3-(4-aminophenyl)-2-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoyl]amino]-N-hydroxybenzamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(Cc2ccc(N)cc2)C(=O)Nc2ccc(C(=O)NO)cc2)cc1OC |
| InChI | InChI=1S/C27H28N4O6/c1-36-23-13-5-18(16-24(23)37-2)6-14-25(32)30-22(15-17-3-9-20(28)10-4-17)27(34)29-21-11-7-19(8-12-21)26(33)31-35/h3-14,16,22,35H,15,28H2,1-2H3,(H,29,34)(H,30,32)(H,31,33)/b14-6+ |
| InChIKey | XBUAXNGPMZNBRE-MKMNVTDBSA-N |
| XLogP | 2.78 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|