C26H29NO4 — CID 146471291
3-methyl-5-[4-[(2R)-6-(oxolane-2-carbonyl)-6-azaspiro[2.5]octan-2-yl]phenyl]benzoic acid (PubChem CID 146471291) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 3-methyl-5-[4-[(2R)-6-(oxolane-2-carbonyl)-6-azaspiro[2.5]octan-2-yl]phenyl]benzoic acid.
| Compound Name | 3-methyl-5-[4-[(2R)-6-(oxolane-2-carbonyl)-6-azaspiro[2.5]octan-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 146471291 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 3-methyl-5-[4-[(2R)-6-(oxolane-2-carbonyl)-6-azaspiro[2.5]octan-2-yl]phenyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(-c2ccc([C@@H]3CC34CCN(C(=O)C3CCCO3)CC4)cc2)c1 |
| InChI | InChI=1S/C26H29NO4/c1-17-13-20(15-21(14-17)25(29)30)18-4-6-19(7-5-18)22-16-26(22)8-10-27(11-9-26)24(28)23-3-2-12-31-23/h4-7,13-15,22-23H,2-3,8-12,16H2,1H3,(H,29,30)/t22-,23?/m0/s1 |
| InChIKey | WRHOABWVMGNLTQ-NQCNTLBGSA-N |
| XLogP | 4.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |