C25H30N5O2+ — CID 172954018
[(Z)-C-[4-[4-[(2S)-6-[(2R)-oxolane-2-carbonyl]-6-azaspiro[2.5]octan-2-yl]phenyl]phenyl]carbonohydrazonoyl]iminoazanium (PubChem CID 172954018) has the molecular formula C25H30N5O2+ and a molecular weight of 432.55 g/mol. Its IUPAC name is [(Z)-C-[4-[4-[(2S)-6-[(2R)-oxolane-2-carbonyl]-6-azaspiro[2.5]octan-2-yl]phenyl]phenyl]carbonohydrazonoyl]iminoazanium.
| Compound Name | [(Z)-C-[4-[4-[(2S)-6-[(2R)-oxolane-2-carbonyl]-6-azaspiro[2.5]octan-2-yl]phenyl]phenyl]carbonohydrazonoyl]iminoazanium |
|---|---|
| PubChem CID | 172954018 |
| Molecular Formula | C25H30N5O2+ |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [(Z)-C-[4-[4-[(2S)-6-[(2R)-oxolane-2-carbonyl]-6-azaspiro[2.5]octan-2-yl]phenyl]phenyl]carbonohydrazonoyl]iminoazanium |
| SMILES | N/N=C(\N=[NH2+])c1ccc(-c2ccc([C@H]3CC34CCN(C(=O)[C@H]3CCCO3)CC4)cc2)cc1 |
| InChI | InChI=1S/C25H29N5O2/c26-28-23(29-27)20-9-5-18(6-10-20)17-3-7-19(8-4-17)21-16-25(21)11-13-30(14-12-25)24(31)22-2-1-15-32-22/h3-10,21-22,26H,1-2,11-16,27H2/p+1/b28-26?,29-23-/t21-,22-/m1/s1 |
| InChIKey | XFNFAVOKLPCOIB-ZMFABNRZSA-O |
| XLogP | 2.46 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|