C17H20BrNO2 — CID 146471082
[2-(4-bromophenyl)-5-azaspiro[2.4]heptan-5-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 146471082) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is [2-(4-bromophenyl)-5-azaspiro[2.4]heptan-5-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [2-(4-bromophenyl)-5-azaspiro[2.4]heptan-5-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 146471082 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [2-(4-bromophenyl)-5-azaspiro[2.4]heptan-5-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | O=C([C@H]1CCCO1)N1CCC2(CC2c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H20BrNO2/c18-13-5-3-12(4-6-13)14-10-17(14)7-8-19(11-17)16(20)15-2-1-9-21-15/h3-6,14-15H,1-2,7-11H2/t14?,15-,17?/m1/s1 |
| InChIKey | QYLAXLAGGMYMIL-ISXOHVOVSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |