C17H29NO6 — CID 146471479
2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)propoxy]propanoic acid (PubChem CID 146471479) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)propoxy]propanoic acid.
| Compound Name | 2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)propoxy]propanoic acid |
|---|---|
| PubChem CID | 146471479 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)propoxy]propanoic acid |
| SMILES | C=CCCC(=O)N(C)C(COCC(C)OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C17H29NO6/c1-4-5-8-15(19)18(3)14(17(20)21)12-22-11-13(2)24-16-9-6-7-10-23-16/h4,13-14,16H,1,5-12H2,2-3H3,(H,20,21) |
| InChIKey | HWYBDHQWXSDZSB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|