C16H27NO6 — CID 146471463
2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)ethoxy]propanoic acid (PubChem CID 146471463) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)ethoxy]propanoic acid.
| Compound Name | 2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 146471463 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-[methyl(pent-4-enoyl)amino]-3-[2-(oxan-2-yloxy)ethoxy]propanoic acid |
| SMILES | C=CCCC(=O)N(C)C(COCCOC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C16H27NO6/c1-3-4-7-14(18)17(2)13(16(19)20)12-21-10-11-23-15-8-5-6-9-22-15/h3,13,15H,1,4-12H2,2H3,(H,19,20) |
| InChIKey | WZROGLVBUOHZCP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|