C17H26N2O6 — CID 142490678
cyanomethyl (2S)-3-[2-(oxan-2-yloxy)ethoxy]-2-(pent-4-enoylamino)propanoate (PubChem CID 142490678) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is cyanomethyl (2S)-3-[2-(oxan-2-yloxy)ethoxy]-2-(pent-4-enoylamino)propanoate.
| Compound Name | cyanomethyl (2S)-3-[2-(oxan-2-yloxy)ethoxy]-2-(pent-4-enoylamino)propanoate |
|---|---|
| PubChem CID | 142490678 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | cyanomethyl (2S)-3-[2-(oxan-2-yloxy)ethoxy]-2-(pent-4-enoylamino)propanoate |
| SMILES | C=CCCC(=O)N[C@@H](COCCOC1CCCCO1)C(=O)OCC#N |
| InChI | InChI=1S/C17H26N2O6/c1-2-3-6-15(20)19-14(17(21)25-10-8-18)13-22-11-12-24-16-7-4-5-9-23-16/h2,14,16H,1,3-7,9-13H2,(H,19,20)/t14-,16?/m0/s1 |
| InChIKey | VVXPJBOFEFHHSF-LBAUFKAWSA-N |
| XLogP | 1.06 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|