C25H27N3O4 — CID 155316705
cyanomethyl 2-[[2-(pent-4-enoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoate (PubChem CID 155316705) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is cyanomethyl 2-[[2-(pent-4-enoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoate.
| Compound Name | cyanomethyl 2-[[2-(pent-4-enoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 155316705 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | cyanomethyl 2-[[2-(pent-4-enoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoate |
| SMILES | C=CCCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)OCC#N |
| InChI | InChI=1S/C25H27N3O4/c1-2-3-14-23(29)27-21(17-19-10-6-4-7-11-19)24(30)28-22(25(31)32-16-15-26)18-20-12-8-5-9-13-20/h2,4-13,21-22H,1,3,14,16-18H2,(H,27,29)(H,28,30) |
| InChIKey | NDWNGVGNSOWGPA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|