C31H40N4O6 — CID 46878871
pent-4-enyl (2S)-5-amino-5-oxo-2-[[(2S)-3-phenyl-2-[[(2S)-2-(3-phenylpropanoylamino)propanoyl]amino]propanoyl]amino]pentanoate (PubChem CID 46878871) has the molecular formula C31H40N4O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is pent-4-enyl (2S)-5-amino-5-oxo-2-[[(2S)-3-phenyl-2-[[(2S)-2-(3-phenylpropanoylamino)propanoyl]amino]propanoyl]amino]pentanoate.
| Compound Name | pent-4-enyl (2S)-5-amino-5-oxo-2-[[(2S)-3-phenyl-2-[[(2S)-2-(3-phenylpropanoylamino)propanoyl]amino]propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 46878871 |
| Molecular Formula | C31H40N4O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | pent-4-enyl (2S)-5-amino-5-oxo-2-[[(2S)-3-phenyl-2-[[(2S)-2-(3-phenylpropanoylamino)propanoyl]amino]propanoyl]amino]pentanoate |
| SMILES | C=CCCCOC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C31H40N4O6/c1-3-4-11-20-41-31(40)25(17-18-27(32)36)34-30(39)26(21-24-14-9-6-10-15-24)35-29(38)22(2)33-28(37)19-16-23-12-7-5-8-13-23/h3,5-10,12-15,22,25-26H,1,4,11,16-21H2,2H3,(H2,32,36)(H,33,37)(H,34,39)(H,35,38)/t22-,25-,26-/m0/s1 |
| InChIKey | MHUAFFBJCBBULA-HRNNMHKYSA-N |
| XLogP | 2.11 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|