C16H17ClN2O4 — CID 146471584
3-(3-chlorophenoxy)-2-[cyanomethyl(pent-4-enoyl)amino]propanoic acid (PubChem CID 146471584) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-2-[cyanomethyl(pent-4-enoyl)amino]propanoic acid.
| Compound Name | 3-(3-chlorophenoxy)-2-[cyanomethyl(pent-4-enoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 146471584 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-(3-chlorophenoxy)-2-[cyanomethyl(pent-4-enoyl)amino]propanoic acid |
| SMILES | C=CCCC(=O)N(CC#N)C(COc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C16H17ClN2O4/c1-2-3-7-15(20)19(9-8-18)14(16(21)22)11-23-13-6-4-5-12(17)10-13/h2,4-6,10,14H,1,3,7,9,11H2,(H,21,22) |
| InChIKey | QQIIVKLAKFRCNY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|