C23H33F3N4O5S2 — CID 146471992
(3R)-3-[4-[2-methylpropyl(5-methylsulfonyloxypentyl)amino]-3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]phenyl]butanoic acid (PubChem CID 146471992) has the molecular formula C23H33F3N4O5S2 and a molecular weight of 566.67 g/mol. Its IUPAC name is (3R)-3-[4-[2-methylpropyl(5-methylsulfonyloxypentyl)amino]-3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]phenyl]butanoic acid.
| Compound Name | (3R)-3-[4-[2-methylpropyl(5-methylsulfonyloxypentyl)amino]-3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 146471992 |
| Molecular Formula | C23H33F3N4O5S2 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | (3R)-3-[4-[2-methylpropyl(5-methylsulfonyloxypentyl)amino]-3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]phenyl]butanoic acid |
| SMILES | CC(C)CN(CCCCCOS(C)(=O)=O)c1ccc([C@H](C)CC(=O)O)cc1Nc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C23H33F3N4O5S2/c1-15(2)14-30(10-6-5-7-11-35-37(4,33)34)19-9-8-17(16(3)12-20(31)32)13-18(19)27-22-28-21(29-36-22)23(24,25)26/h8-9,13,15-16H,5-7,10-12,14H2,1-4H3,(H,31,32)(H,27,28,29)/t16-/m1/s1 |
| InChIKey | YIFGLKPRNGDLHC-MRXNPFEDSA-N |
| XLogP | 5.49 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|