C22H31ClN4O2 — CID 126722142
3-[4-[bis(2-methylpropyl)amino]-3-[(2-chloropyrimidin-4-yl)amino]phenyl]butanoic acid (PubChem CID 126722142) has the molecular formula C22H31ClN4O2 and a molecular weight of 418.97 g/mol. Its IUPAC name is 3-[4-[bis(2-methylpropyl)amino]-3-[(2-chloropyrimidin-4-yl)amino]phenyl]butanoic acid.
| Compound Name | 3-[4-[bis(2-methylpropyl)amino]-3-[(2-chloropyrimidin-4-yl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 126722142 |
| Molecular Formula | C22H31ClN4O2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3-[4-[bis(2-methylpropyl)amino]-3-[(2-chloropyrimidin-4-yl)amino]phenyl]butanoic acid |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C(C)CC(=O)O)cc1Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C22H31ClN4O2/c1-14(2)12-27(13-15(3)4)19-7-6-17(16(5)10-21(28)29)11-18(19)25-20-8-9-24-22(23)26-20/h6-9,11,14-16H,10,12-13H2,1-5H3,(H,28,29)(H,24,25,26) |
| InChIKey | PRSUXNQGQBNXCO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |