C20H32N6O2 — CID 135171997
3-[4-[bis(2-methylpropyl)amino]-3-[(2-methyltetrazol-5-yl)amino]phenyl]butanoic acid (PubChem CID 135171997) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-[4-[bis(2-methylpropyl)amino]-3-[(2-methyltetrazol-5-yl)amino]phenyl]butanoic acid.
| Compound Name | 3-[4-[bis(2-methylpropyl)amino]-3-[(2-methyltetrazol-5-yl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 135171997 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 3-[4-[bis(2-methylpropyl)amino]-3-[(2-methyltetrazol-5-yl)amino]phenyl]butanoic acid |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C(C)CC(=O)O)cc1Nc1nnn(C)n1 |
| InChI | InChI=1S/C20H32N6O2/c1-13(2)11-26(12-14(3)4)18-8-7-16(15(5)9-19(27)28)10-17(18)21-20-22-24-25(6)23-20/h7-8,10,13-15H,9,11-12H2,1-6H3,(H,21,23)(H,27,28) |
| InChIKey | CTFWNZKMSMSICA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |