C12H21F3N2O2 — CID 146472128
[2-amino-4-(trifluoromethyl)cyclohexyl]-tert-butylcarbamic acid (PubChem CID 146472128) has the molecular formula C12H21F3N2O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is [2-amino-4-(trifluoromethyl)cyclohexyl]-tert-butylcarbamic acid.
| Compound Name | [2-amino-4-(trifluoromethyl)cyclohexyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 146472128 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | [2-amino-4-(trifluoromethyl)cyclohexyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCC(C(F)(F)F)CC1N |
| InChI | InChI=1S/C12H21F3N2O2/c1-11(2,3)17(10(18)19)9-5-4-7(6-8(9)16)12(13,14)15/h7-9H,4-6,16H2,1-3H3,(H,18,19) |
| InChIKey | SBYGEVJEXUZYIQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |