C10H19N3O3 — CID 118874609
[(4R,5R)-5-amino-2-oxopiperidin-4-yl]-tert-butylcarbamic acid (PubChem CID 118874609) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is [(4R,5R)-5-amino-2-oxopiperidin-4-yl]-tert-butylcarbamic acid.
| Compound Name | [(4R,5R)-5-amino-2-oxopiperidin-4-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 118874609 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | [(4R,5R)-5-amino-2-oxopiperidin-4-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@@H]1CC(=O)NC[C@H]1N |
| InChI | InChI=1S/C10H19N3O3/c1-10(2,3)13(9(15)16)7-4-8(14)12-5-6(7)11/h6-7H,4-5,11H2,1-3H3,(H,12,14)(H,15,16)/t6-,7-/m1/s1 |
| InChIKey | GTOYZFIJRANQQG-RNFRBKRXSA-N |
| XLogP | -0.02 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |