C6H11N3O3 — CID 90426122
[(4S,5R)-5-amino-2-oxopiperidin-4-yl]carbamic acid (PubChem CID 90426122) has the molecular formula C6H11N3O3 and a molecular weight of 173.17 g/mol. Its IUPAC name is [(4S,5R)-5-amino-2-oxopiperidin-4-yl]carbamic acid.
| Compound Name | [(4S,5R)-5-amino-2-oxopiperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 90426122 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | [(4S,5R)-5-amino-2-oxopiperidin-4-yl]carbamic acid |
| SMILES | N[C@@H]1CNC(=O)C[C@@H]1NC(=O)O |
| InChI | InChI=1S/C6H11N3O3/c7-3-2-8-5(10)1-4(3)9-6(11)12/h3-4,9H,1-2,7H2,(H,8,10)(H,11,12)/t3-,4+/m1/s1 |
| InChIKey | XGWFLMSVJIRWRC-DMTCNVIQSA-N |
| XLogP | -1.53 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |