About [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid
[(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid (PubChem CID 138684888) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid |
| PubChem CID | 138684888 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CC(=O)N[C@H]1C1CC1 |
| InChI | InChI=1S/C8H12N2O3/c11-6-3-5(9-8(12)13)7(10-6)4-1-2-4/h4-5,7,9H,1-3H2,(H,10,11)(H,12,13)/t5-,7-/m0/s1 |
| InChIKey | FLNJINNZFSEBLJ-FSPLSTOPSA-N |
| XLogP | -0.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid?
The IUPAC name of [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid (CID 138684888) is [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid.
What is the SMILES notation for [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid?
The canonical SMILES for [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid is O=C(O)N[C@H]1CC(=O)N[C@H]1C1CC1.
What is the InChIKey of [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid?
The InChIKey is FLNJINNZFSEBLJ-FSPLSTOPSA-N. The full InChI is InChI=1S/C8H12N2O3/c11-6-3-5(9-8(12)13)7(10-6)4-1-2-4/h4-5,7,9H,1-3H2,(H,10,11)(H,12,13)/t5-,7-/m0/s1.
What are the key properties of [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid?
[(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid has a molecular weight of 184.19 g/mol, XLogP of -0.08, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2-cyclopropyl-5-oxopyrrolidin-3-yl]carbamic acid is sourced from PubChem (CID 138684888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).