C13H21N3O3 — CID 129349017
N-[(2R,3R)-2-cyclopropyl-6-oxopiperidin-3-yl]morpholine-4-carboxamide (PubChem CID 129349017) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(2R,3R)-2-cyclopropyl-6-oxopiperidin-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2R,3R)-2-cyclopropyl-6-oxopiperidin-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 129349017 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[(2R,3R)-2-cyclopropyl-6-oxopiperidin-3-yl]morpholine-4-carboxamide |
| SMILES | O=C1CC[C@@H](NC(=O)N2CCOCC2)[C@@H](C2CC2)N1 |
| InChI | InChI=1S/C13H21N3O3/c17-11-4-3-10(12(15-11)9-1-2-9)14-13(18)16-5-7-19-8-6-16/h9-10,12H,1-8H2,(H,14,18)(H,15,17)/t10-,12-/m1/s1 |
| InChIKey | NIVQIHGUICSUFN-ZYHUDNBSSA-N |
| XLogP | 0.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |