C25H32N6O4S — CID 146472685
[3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-[[(6S)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]pyrazin-2-yl]methyl formate (PubChem CID 146472685) has the molecular formula C25H32N6O4S and a molecular weight of 512.64 g/mol. Its IUPAC name is [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-[[(6S)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]pyrazin-2-yl]methyl formate.
| Compound Name | [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-[[(6S)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]pyrazin-2-yl]methyl formate |
|---|---|
| PubChem CID | 146472685 |
| Molecular Formula | C25H32N6O4S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-[[(6S)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-10-yl]sulfanyl]pyrazin-2-yl]methyl formate |
| SMILES | C[C@@H]1OCC2(CCN(c3ncc(Sc4ccnc5c4OC[C@@H]4CCCN54)nc3COC=O)CC2)[C@@H]1N |
| InChI | InChI=1S/C25H32N6O4S/c1-16-22(26)25(14-35-16)5-9-30(10-6-25)23-18(13-33-15-32)29-20(11-28-23)36-19-4-7-27-24-21(19)34-12-17-3-2-8-31(17)24/h4,7,11,15-17,22H,2-3,5-6,8-10,12-14,26H2,1H3/t16-,17-,22+/m0/s1 |
| InChIKey | OAOWTOZRJMHRBA-PNLZDCPESA-N |
| XLogP | 2.39 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|