C25H33N7O5S — CID 146510526
[[(3S,4S)-8-[5-[[(6S)-12-amino-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-10-yl]sulfanyl]-3-(hydroxymethyl)pyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino] formate (PubChem CID 146510526) has the molecular formula C25H33N7O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is [[(3S,4S)-8-[5-[[(6S)-12-amino-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-10-yl]sulfanyl]-3-(hydroxymethyl)pyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino] formate.
| Compound Name | [[(3S,4S)-8-[5-[[(6S)-12-amino-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-10-yl]sulfanyl]-3-(hydroxymethyl)pyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino] formate |
|---|---|
| PubChem CID | 146510526 |
| Molecular Formula | C25H33N7O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | [[(3S,4S)-8-[5-[[(6S)-12-amino-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-10-yl]sulfanyl]-3-(hydroxymethyl)pyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino] formate |
| SMILES | C[C@@H]1OCC2(CCN(c3ncc(Sc4cc(N)nc5c4OC[C@@H]4CCCN54)nc3CO)CC2)[C@@H]1NOC=O |
| InChI | InChI=1S/C25H33N7O5S/c1-15-22(30-37-14-34)25(13-36-15)4-7-31(8-5-25)23-17(11-33)28-20(10-27-23)38-18-9-19(26)29-24-21(18)35-12-16-3-2-6-32(16)24/h9-10,14-16,22,30,33H,2-8,11-13H2,1H3,(H2,26,29)/t15-,16-,22+/m0/s1 |
| InChIKey | WNCMJNJHUFYRCI-PONJGIIJSA-N |
| XLogP | 1.51 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|