C13H17IN2O3 — CID 146472707
(6R)-10-iodo-4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (PubChem CID 146472707) has the molecular formula C13H17IN2O3 and a molecular weight of 376.19 g/mol. Its IUPAC name is (6R)-10-iodo-4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene.
| Compound Name | (6R)-10-iodo-4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 146472707 |
| Molecular Formula | C13H17IN2O3 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (6R)-10-iodo-4-(methoxymethoxymethyl)-8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| SMILES | COCOCC1C[C@@H]2COc3c(I)ccnc3N2C1 |
| InChI | InChI=1S/C13H17IN2O3/c1-17-8-18-6-9-4-10-7-19-12-11(14)2-3-15-13(12)16(10)5-9/h2-3,9-10H,4-8H2,1H3/t9?,10-/m1/s1 |
| InChIKey | DXCAPOICVYQFJS-QVDQXJPCSA-N |
| XLogP | 1.89 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|