C10H18N2O6S2 — CID 146474284
(2S)-4-methylsulfanyl-2-[[(2S,4S)-4-sulfopyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 146474284) has the molecular formula C10H18N2O6S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[[(2S,4S)-4-sulfopyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[[(2S,4S)-4-sulfopyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 146474284 |
| Molecular Formula | C10H18N2O6S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[[(2S,4S)-4-sulfopyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1C[C@H](S(=O)(=O)O)CN1)C(=O)O |
| InChI | InChI=1S/C10H18N2O6S2/c1-19-3-2-7(10(14)15)12-9(13)8-4-6(5-11-8)20(16,17)18/h6-8,11H,2-5H2,1H3,(H,12,13)(H,14,15)(H,16,17,18)/t6-,7-,8-/m0/s1 |
| InChIKey | QRXNYDZZGYEJGD-FXQIFTODSA-N |
| XLogP | -1.07 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|