C22H28FN3O5 — CID 146476339
5-[2-[[(1R,2R,3S)-2,3-dihydroxycyclopentyl]amino]-1-hydroxy-2-oxoethyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide (PubChem CID 146476339) has the molecular formula C22H28FN3O5 and a molecular weight of 433.48 g/mol. Its IUPAC name is 5-[2-[[(1R,2R,3S)-2,3-dihydroxycyclopentyl]amino]-1-hydroxy-2-oxoethyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide.
| Compound Name | 5-[2-[[(1R,2R,3S)-2,3-dihydroxycyclopentyl]amino]-1-hydroxy-2-oxoethyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146476339 |
| Molecular Formula | C22H28FN3O5 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 5-[2-[[(1R,2R,3S)-2,3-dihydroxycyclopentyl]amino]-1-hydroxy-2-oxoethyl]-N-(4-fluoro-3-methylphenyl)-1,2,4-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C)c(C(O)C(=O)N[C@@H]3CC[C@H](O)[C@@H]3O)n(C)c2C)ccc1F |
| InChI | InChI=1S/C22H28FN3O5/c1-10-9-13(5-6-14(10)23)24-21(30)17-11(2)18(26(4)12(17)3)20(29)22(31)25-15-7-8-16(27)19(15)28/h5-6,9,15-16,19-20,27-29H,7-8H2,1-4H3,(H,24,30)(H,25,31)/t15-,16+,19-,20?/m1/s1 |
| InChIKey | KBQNZZSIBBEIOJ-LQXLOVGSSA-N |
| XLogP | 1.38 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |