C10H16FN — CID 146476929
(2R)-2-[(3E)-4-fluoropenta-1,3-dien-2-yl]-1-methylpyrrolidine (PubChem CID 146476929) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (2R)-2-[(3E)-4-fluoropenta-1,3-dien-2-yl]-1-methylpyrrolidine.
| Compound Name | (2R)-2-[(3E)-4-fluoropenta-1,3-dien-2-yl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 146476929 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (2R)-2-[(3E)-4-fluoropenta-1,3-dien-2-yl]-1-methylpyrrolidine |
| SMILES | C=C(/C=C(\C)F)[C@H]1CCCN1C |
| InChI | InChI=1S/C10H16FN/c1-8(7-9(2)11)10-5-4-6-12(10)3/h7,10H,1,4-6H2,2-3H3/b9-7+/t10-/m1/s1 |
| InChIKey | PHOYPBZDFIAABV-TTZKWOQHSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|