C19H19ClF2N2O3 — CID 146477431
4-[2-(aminomethyl)prop-2-enoxy]-N-[2-chloro-4-(methoxymethyl)phenyl]-3,5-difluorobenzamide (PubChem CID 146477431) has the molecular formula C19H19ClF2N2O3 and a molecular weight of 396.82 g/mol. Its IUPAC name is 4-[2-(aminomethyl)prop-2-enoxy]-N-[2-chloro-4-(methoxymethyl)phenyl]-3,5-difluorobenzamide.
| Compound Name | 4-[2-(aminomethyl)prop-2-enoxy]-N-[2-chloro-4-(methoxymethyl)phenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 146477431 |
| Molecular Formula | C19H19ClF2N2O3 |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-[2-(aminomethyl)prop-2-enoxy]-N-[2-chloro-4-(methoxymethyl)phenyl]-3,5-difluorobenzamide |
| SMILES | C=C(CN)COc1c(F)cc(C(=O)Nc2ccc(COC)cc2Cl)cc1F |
| InChI | InChI=1S/C19H19ClF2N2O3/c1-11(8-23)9-27-18-15(21)6-13(7-16(18)22)19(25)24-17-4-3-12(10-26-2)5-14(17)20/h3-7H,1,8-10,23H2,2H3,(H,24,25) |
| InChIKey | SGDJRJSUUBJADW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|