C9H14FNO — CID 146478432
(5E)-7-(dimethylamino)-5-fluorohepta-1,5-dien-4-one (PubChem CID 146478432) has the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. Its IUPAC name is (5E)-7-(dimethylamino)-5-fluorohepta-1,5-dien-4-one.
| Compound Name | (5E)-7-(dimethylamino)-5-fluorohepta-1,5-dien-4-one |
|---|---|
| PubChem CID | 146478432 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (5E)-7-(dimethylamino)-5-fluorohepta-1,5-dien-4-one |
| SMILES | C=CCC(=O)/C(F)=C\CN(C)C |
| InChI | InChI=1S/C9H14FNO/c1-4-5-9(12)8(10)6-7-11(2)3/h4,6H,1,5,7H2,2-3H3/b8-6+ |
| InChIKey | CBPAMJDBMRFCJT-SOFGYWHQSA-N |
| XLogP | 1.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|