C18H23N3O2 — CID 146480472
(1R,8S)-5-(3,5-dimethoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene (PubChem CID 146480472) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (1R,8S)-5-(3,5-dimethoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene.
| Compound Name | (1R,8S)-5-(3,5-dimethoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene |
|---|---|
| PubChem CID | 146480472 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (1R,8S)-5-(3,5-dimethoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene |
| SMILES | COc1cc(OC)cc(-c2c3c(nn2C)[C@H]2CCC[C@@H](C3)N2)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-21-18(11-7-13(22-2)10-14(8-11)23-3)15-9-12-5-4-6-16(19-12)17(15)20-21/h7-8,10,12,16,19H,4-6,9H2,1-3H3/t12-,16+/m0/s1 |
| InChIKey | YBLTXTUTPAIAIF-BLLLJJGKSA-N |
| XLogP | 2.84 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |