About 4-propoxyhexan-2-yl 2-formamidopropanoate
4-propoxyhexan-2-yl 2-formamidopropanoate (PubChem CID 146481405) has the molecular formula C13H25NO4
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-propoxyhexan-2-yl 2-formamidopropanoate.
Molecular Properties
| Compound Name | 4-propoxyhexan-2-yl 2-formamidopropanoate |
| PubChem CID | 146481405 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-propoxyhexan-2-yl 2-formamidopropanoate |
| SMILES | CCCOC(CC)CC(C)OC(=O)C(C)NC=O |
| InChI | InChI=1S/C13H25NO4/c1-5-7-17-12(6-2)8-10(3)18-13(16)11(4)14-9-15/h9-12H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | MWSPQPJOBBQHSH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-propoxyhexan-2-yl 2-formamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxyhexan-2-yl 2-formamidopropanoate?
The IUPAC name of 4-propoxyhexan-2-yl 2-formamidopropanoate (CID 146481405) is 4-propoxyhexan-2-yl 2-formamidopropanoate.
What is the SMILES notation for 4-propoxyhexan-2-yl 2-formamidopropanoate?
The canonical SMILES for 4-propoxyhexan-2-yl 2-formamidopropanoate is CCCOC(CC)CC(C)OC(=O)C(C)NC=O.
What is the InChIKey of 4-propoxyhexan-2-yl 2-formamidopropanoate?
The InChIKey is MWSPQPJOBBQHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO4/c1-5-7-17-12(6-2)8-10(3)18-13(16)11(4)14-9-15/h9-12H,5-8H2,1-4H3,(H,14,15).
What are the key properties of 4-propoxyhexan-2-yl 2-formamidopropanoate?
4-propoxyhexan-2-yl 2-formamidopropanoate has a molecular weight of 259.35 g/mol, XLogP of 1.65, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxyhexan-2-yl 2-formamidopropanoate is sourced from PubChem (CID 146481405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).