About (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate
(3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate (PubChem CID 146481418) has the molecular formula C12H23NO4
and a molecular weight of 245.32 g/mol. Its IUPAC name is (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate.
Molecular Properties
| Compound Name | (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate |
| PubChem CID | 146481418 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate |
| SMILES | CCCOCC(C)C(C)OC(=O)C(C)NC=O |
| InChI | InChI=1S/C12H23NO4/c1-5-6-16-7-9(2)11(4)17-12(15)10(3)13-8-14/h8-11H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | HMLSOALFPPEHAU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate?
The IUPAC name of (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate (CID 146481418) is (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate.
What is the SMILES notation for (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate?
The canonical SMILES for (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate is CCCOCC(C)C(C)OC(=O)C(C)NC=O.
What is the InChIKey of (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate?
The InChIKey is HMLSOALFPPEHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4/c1-5-6-16-7-9(2)11(4)17-12(15)10(3)13-8-14/h8-11H,5-7H2,1-4H3,(H,13,14).
What are the key properties of (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate?
(3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate has a molecular weight of 245.32 g/mol, XLogP of 1.12, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-4-propoxybutan-2-yl) 2-formamidopropanoate is sourced from PubChem (CID 146481418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).