C18H40N2O3 — CID 167491163
N-[1-(2-methylpropoxy)-3-propoxypropan-2-yl]formamide;2,3,3-trimethylbutan-2-amine (PubChem CID 167491163) has the molecular formula C18H40N2O3 and a molecular weight of 332.53 g/mol. Its IUPAC name is N-[1-(2-methylpropoxy)-3-propoxypropan-2-yl]formamide;2,3,3-trimethylbutan-2-amine.
| Compound Name | N-[1-(2-methylpropoxy)-3-propoxypropan-2-yl]formamide;2,3,3-trimethylbutan-2-amine |
|---|---|
| PubChem CID | 167491163 |
| Molecular Formula | C18H40N2O3 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.30 |
| IUPAC Name | N-[1-(2-methylpropoxy)-3-propoxypropan-2-yl]formamide;2,3,3-trimethylbutan-2-amine |
| SMILES | CC(C)(C)C(C)(C)N.CCCOCC(COCC(C)C)NC=O |
| InChI | InChI=1S/C11H23NO3.C7H17N/c1-4-5-14-7-11(12-9-13)8-15-6-10(2)3;1-6(2,3)7(4,5)8/h9-11H,4-8H2,1-3H3,(H,12,13);8H2,1-5H3 |
| InChIKey | WMPIOYYFXKQDOZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|