C11H24O — CID 121286105
2,3,4-trimethyl-1-propoxypentane (PubChem CID 121286105) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is 2,3,4-trimethyl-1-propoxypentane.
| Compound Name | 2,3,4-trimethyl-1-propoxypentane |
|---|---|
| PubChem CID | 121286105 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 2,3,4-trimethyl-1-propoxypentane |
| SMILES | CCCOCC(C)C(C)C(C)C |
| InChI | InChI=1S/C11H24O/c1-6-7-12-8-10(4)11(5)9(2)3/h9-11H,6-8H2,1-5H3 |
| InChIKey | CWPPADCNLGVJHB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|