C12H26O — CID 157134146
1-(2,3-dimethylbutoxy)-4-methylpentane (PubChem CID 157134146) has the molecular formula C12H26O and a molecular weight of 186.34 g/mol. Its IUPAC name is 1-(2,3-dimethylbutoxy)-4-methylpentane.
| Compound Name | 1-(2,3-dimethylbutoxy)-4-methylpentane |
|---|---|
| PubChem CID | 157134146 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 1-(2,3-dimethylbutoxy)-4-methylpentane |
| SMILES | CC(C)CCCOCC(C)C(C)C |
| InChI | InChI=1S/C12H26O/c1-10(2)7-6-8-13-9-12(5)11(3)4/h10-12H,6-9H2,1-5H3 |
| InChIKey | CYOAGRHLKNPCJJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|