C21H46O2 — CID 159973064
3,4-dimethyl-1-(2-methylpropoxy)pentane;4-methyl-1-(2-methylpropoxy)pentane (PubChem CID 159973064) has the molecular formula C21H46O2 and a molecular weight of 330.60 g/mol. Its IUPAC name is 3,4-dimethyl-1-(2-methylpropoxy)pentane;4-methyl-1-(2-methylpropoxy)pentane.
| Compound Name | 3,4-dimethyl-1-(2-methylpropoxy)pentane;4-methyl-1-(2-methylpropoxy)pentane |
|---|---|
| PubChem CID | 159973064 |
| Molecular Formula | C21H46O2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.35 |
| IUPAC Name | 3,4-dimethyl-1-(2-methylpropoxy)pentane;4-methyl-1-(2-methylpropoxy)pentane |
| SMILES | CC(C)CCCOCC(C)C.CC(C)COCCC(C)C(C)C |
| InChI | InChI=1S/C11H24O.C10H22O/c1-9(2)8-12-7-6-11(5)10(3)4;1-9(2)6-5-7-11-8-10(3)4/h9-11H,6-8H2,1-5H3;9-10H,5-8H2,1-4H3 |
| InChIKey | OEUOBGJTIXUBFD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|