C35H34N6O2 — CID 146481712
5-[(2R,6R)-6-amino-4-[(1-trityl-1,2,4-triazol-3-yl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one (PubChem CID 146481712) has the molecular formula C35H34N6O2 and a molecular weight of 570.70 g/mol. Its IUPAC name is 5-[(2R,6R)-6-amino-4-[(1-trityl-1,2,4-triazol-3-yl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 5-[(2R,6R)-6-amino-4-[(1-trityl-1,2,4-triazol-3-yl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 146481712 |
| Molecular Formula | C35H34N6O2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 5-[(2R,6R)-6-amino-4-[(1-trityl-1,2,4-triazol-3-yl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one |
| SMILES | Cc1c([C@@H]2CN(Cc3ncn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)C[C@H](N)N2)ccc2c1COC2=O |
| InChI | InChI=1S/C35H34N6O2/c1-24-28(17-18-29-30(24)22-43-34(29)42)31-19-40(20-32(36)38-31)21-33-37-23-41(39-33)35(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-18,23,31-32,38H,19-22,36H2,1H3/t31-,32+/m0/s1 |
| InChIKey | AQSVADBZYQBBOE-AJQTZOPKSA-N |
| XLogP | 4.53 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|