C19H21BrN4O2 — CID 170287292
5-[(2R,6R)-6-amino-4-[(6-bromo-3-pyridinyl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one (PubChem CID 170287292) has the molecular formula C19H21BrN4O2 and a molecular weight of 417.31 g/mol. Its IUPAC name is 5-[(2R,6R)-6-amino-4-[(6-bromo-3-pyridinyl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 5-[(2R,6R)-6-amino-4-[(6-bromo-3-pyridinyl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 170287292 |
| Molecular Formula | C19H21BrN4O2 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 5-[(2R,6R)-6-amino-4-[(6-bromo-3-pyridinyl)methyl]piperazin-2-yl]-4-methyl-3H-2-benzofuran-1-one |
| SMILES | Cc1c([C@@H]2CN(Cc3ccc(Br)nc3)C[C@H](N)N2)ccc2c1COC2=O |
| InChI | InChI=1S/C19H21BrN4O2/c1-11-13(3-4-14-15(11)10-26-19(14)25)16-8-24(9-18(21)23-16)7-12-2-5-17(20)22-6-12/h2-6,16,18,23H,7-10,21H2,1H3/t16-,18+/m0/s1 |
| InChIKey | MAYRBPFORONHKI-FUHWJXTLSA-N |
| XLogP | 2.25 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|