C24H32Cl2N6O2S — CID 146482518
tert-butyl N-[[1-[5-(2,3-dichlorophenyl)sulfanyl-1-ethanimidoyl-6-iminopyrimidin-2-yl]-4-methylpiperidin-4-yl]methyl]carbamate (PubChem CID 146482518) has the molecular formula C24H32Cl2N6O2S and a molecular weight of 539.53 g/mol. Its IUPAC name is tert-butyl N-[[1-[5-(2,3-dichlorophenyl)sulfanyl-1-ethanimidoyl-6-iminopyrimidin-2-yl]-4-methylpiperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[5-(2,3-dichlorophenyl)sulfanyl-1-ethanimidoyl-6-iminopyrimidin-2-yl]-4-methylpiperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 146482518 |
| Molecular Formula | C24H32Cl2N6O2S |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | tert-butyl N-[[1-[5-(2,3-dichlorophenyl)sulfanyl-1-ethanimidoyl-6-iminopyrimidin-2-yl]-4-methylpiperidin-4-yl]methyl]carbamate |
| SMILES | [H]/N=C(\C)n1c(N2CCC(C)(CNC(=O)OC(C)(C)C)CC2)ncc(Sc2cccc(Cl)c2Cl)/c1=N\[H] |
| InChI | InChI=1S/C24H32Cl2N6O2S/c1-15(27)32-20(28)18(35-17-8-6-7-16(25)19(17)26)13-29-21(32)31-11-9-24(5,10-12-31)14-30-22(33)34-23(2,3)4/h6-8,13,27-28H,9-12,14H2,1-5H3,(H,30,33)/b27-15+,28-20+ |
| InChIKey | FIVKGUAKUJLXHI-OIDRWEIVSA-N |
| XLogP | 5.80 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|